ChemNet > CAS > 220227-37-2 3,4,5-trifluorobenzyl alcohol
220227-37-2 3,4,5-trifluorobenzyl alcohol
Nazwa produktu: |
3,4,5-trifluorobenzyl alcohol |
Synonimy |
3,4,5-trifluorobenzenemethanol; (3,4,5-trifluorophenyl)methanol |
MF |
C7H5F3O |
Masie cząsteczkowej |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
Nr CAS |
220227-37-2 |
Struktury molekularnej |
|
Gęstość |
1.398g/cm3 |
Temperatura wrzenia |
192.1°C at 760 mmHg |
Współczynnik załamania |
1.476 |
Temperatura zapłonu |
83°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|